| Name |
{[2-(Methoxymethyl)-1,3-thiazol-4-yl]methyl}[2-(methylamino)ethyl](2,2,2-trifluoroethyl)amine
|
| Molecular Formula |
C11H18F3N3OS
|
| Molecular Weight |
297.34
|
| Smiles |
CNCCN(Cc1csc(COC)n1)CC(F)(F)F
|
CNCCN(Cc1csc(COC)n1)CC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.