| Name |
[(5-Methyl-1,3,4-thiadiazol-2-yl)methyl][2-(methylamino)ethyl](2,2,2-trifluoroethyl)amine
|
| Molecular Formula |
C9H15F3N4S
|
| Molecular Weight |
268.31
|
| Smiles |
CNCCN(Cc1nnc(C)s1)CC(F)(F)F
|
CNCCN(Cc1nnc(C)s1)CC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.