| Name |
4-bromo-3-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)benzoic acid
|
| Molecular Formula |
C26H23BrN2O5S
|
| Molecular Weight |
555.4
|
| Smiles |
O=C(CSCCNC(=O)OCC1c2ccccc2-c2ccccc21)Nc1cc(C(=O)O)ccc1Br
|
O=C(CSCCNC(=O)OCC1c2ccccc2-c2ccccc21)Nc1cc(C(=O)O)ccc1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.