| Name |
benzyl N-cyclohexyl-N-{3-iodoimidazo[1,2-b]pyridazin-6-yl}carbamate
|
| Molecular Formula |
C20H21IN4O2
|
| Molecular Weight |
476.3
|
| Smiles |
O=C(OCc1ccccc1)N(c1ccc2ncc(I)n2n1)C1CCCCC1
|
O=C(OCc1ccccc1)N(c1ccc2ncc(I)n2n1)C1CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.