| Name |
(3S)-3-(2-chloro-1,3-thiazol-5-yl)-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid
|
| Molecular Formula |
C21H17ClN2O4S
|
| Molecular Weight |
428.9
|
| Smiles |
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cnc(Cl)s1
|
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cnc(Cl)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.