| Name |
2,6-Difluoro-3-(3-methyl-1,2-thiazol-5-yl)aniline
|
| Molecular Formula |
C10H8F2N2S
|
| Molecular Weight |
226.25
|
| Smiles |
Cc1cc(-c2ccc(F)c(N)c2F)sn1
|
Cc1cc(-c2ccc(F)c(N)c2F)sn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.