| Name |
5',6'-Dimethoxy-1',2'-dihydrospiro[cyclopropane-1,3'-indole]-2-amine
|
| Molecular Formula |
C12H16N2O2
|
| Molecular Weight |
220.27
|
| Smiles |
COc1cc2c(cc1OC)C1(CN2)CC1N
|
COc1cc2c(cc1OC)C1(CN2)CC1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.