| Name |
2-(5-Bromo-[1,1'-biphenyl]-2-yl)-4,6-diphenyl-1,3,5-triazine
|
| Molecular Formula |
C27H18BrN3
|
| Molecular Weight |
464.4
|
| Smiles |
Brc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccccc2)c1
|
Brc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccccc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.