| Name |
9-fluoro-3-{2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl}[1]benzothieno[3,2-d]pyrimidin-4(3H)-one
|
| Molecular Formula |
C22H18F2N4O2S
|
| Molecular Weight |
440.5
|
| Smiles |
O=C(Cn1cnc2c(sc3cccc(F)c32)c1=O)N1CCN(c2ccccc2F)CC1
|
O=C(Cn1cnc2c(sc3cccc(F)c32)c1=O)N1CCN(c2ccccc2F)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.