| Name |
2-(4-Chlorophenyl)-5,6-dihydroxy-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile
|
| Molecular Formula |
C15H17ClN4O2
|
| Molecular Weight |
320.77
|
| Smiles |
N#CC(CCC(O)CO)(Cn1cncn1)c1ccc(Cl)cc1
|
N#CC(CCC(O)CO)(Cn1cncn1)c1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.