| Name |
2-(2-Chlorophenyl)-4H,5H,6H,7H-[1,3]thiazolo[5,4-c]pyridine
|
| Molecular Formula |
C12H11ClN2S
|
| Molecular Weight |
250.75
|
| Smiles |
Clc1ccccc1-c1nc2c(s1)CNCC2
|
Clc1ccccc1-c1nc2c(s1)CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.