| Name |
3-benzyl-2-({[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-3H,4H-thieno[3,2-d]pyrimidin-4-one
|
| Molecular Formula |
C23H18N4O2S2
|
| Molecular Weight |
446.5
|
| Smiles |
Cc1cccc(-c2noc(CSc3nc4ccsc4c(=O)n3Cc3ccccc3)n2)c1
|
Cc1cccc(-c2noc(CSc3nc4ccsc4c(=O)n3Cc3ccccc3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.