| Name |
(2E,4Z,7S)-1-Methylethyl 11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
|
| Molecular Formula |
C19H34O3
|
| Molecular Weight |
310.5
|
| Smiles |
COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C
|
COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.