| Name |
1-((3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl)methyl)-3-(3-methoxypropyl)quinazoline-2,4(1H,3H)-dione
|
| Molecular Formula |
C21H19ClN4O4
|
| Molecular Weight |
426.9
|
| Smiles |
COCCCn1c(=O)c2ccccc2n(Cc2nc(-c3ccccc3Cl)no2)c1=O
|
COCCCn1c(=O)c2ccccc2n(Cc2nc(-c3ccccc3Cl)no2)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.