| Name |
1-[(3,5-Dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-{[4-(thiophen-2-yl)-1,3-thiazol-2-yl]methyl}piperazine
|
| Molecular Formula |
C17H20N4O3S3
|
| Molecular Weight |
424.6
|
| Smiles |
Cc1noc(C)c1S(=O)(=O)N1CCN(Cc2nc(-c3cccs3)cs2)CC1
|
Cc1noc(C)c1S(=O)(=O)N1CCN(Cc2nc(-c3cccs3)cs2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.