| Name |
5-Azido-1-benzyl-3,3-difluoro-piperidine
|
| Molecular Formula |
C12H14F2N4
|
| Molecular Weight |
252.26
|
| Smiles |
[N-]=[N+]=NC1CN(Cc2ccccc2)CC(F)(F)C1
|
[N-]=[N+]=NC1CN(Cc2ccccc2)CC(F)(F)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.