| Name |
N-(5-chloro-2,4-dimethoxyphenyl)-2-{[3-(thiomorpholin-4-yl)pyrazin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C18H21ClN4O3S2
|
| Molecular Weight |
441.0
|
| Smiles |
COc1cc(OC)c(NC(=O)CSc2nccnc2N2CCSCC2)cc1Cl
|
COc1cc(OC)c(NC(=O)CSc2nccnc2N2CCSCC2)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.