| Name |
4-(2,3-Difluorophenyl)-3,5,6,8-tetraazatricyclo[7.3.0.0{2,6}]dodeca-1(9),2,4,7-tetraene
|
| Molecular Formula |
C14H10F2N4
|
| Molecular Weight |
272.25
|
| Smiles |
Fc1cccc(-c2nc3c4c(ncn3n2)CCC4)c1F
|
Fc1cccc(-c2nc3c4c(ncn3n2)CCC4)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.