| Name |
ethyl 2-(2-(3-oxo-8-phenoxy-[1,2,4]triazolo[4,3-a]pyrazin-2(3H)-yl)acetamido)benzoate
|
| Molecular Formula |
C22H19N5O5
|
| Molecular Weight |
433.4
|
| Smiles |
CCOC(=O)c1ccccc1NC(=O)Cn1nc2c(Oc3ccccc3)nccn2c1=O
|
CCOC(=O)c1ccccc1NC(=O)Cn1nc2c(Oc3ccccc3)nccn2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.