| Name |
7-(tert-Butyl) 5-methyl 3-fluoropyrazolo[1,5-a]pyrimidine-5,7-dicarboxylate
|
| Molecular Formula |
C13H14FN3O4
|
| Molecular Weight |
295.27
|
| Smiles |
COC(=O)c1cc(C(=O)OC(C)(C)C)n2ncc(F)c2n1
|
COC(=O)c1cc(C(=O)OC(C)(C)C)n2ncc(F)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.