| Name |
3-Ethyl 1-tert-butyl 3-(2-methylprop-2-en-1-yl)piperidine-1,3-dicarboxylate
|
| Molecular Formula |
C17H29NO4
|
| Molecular Weight |
311.4
|
| Smiles |
C=C(C)CC1(C(=O)OCC)CCCN(C(=O)OC(C)(C)C)C1
|
C=C(C)CC1(C(=O)OCC)CCCN(C(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.