| Name |
Methyl 2-deoxy-D-erythropentafuranose 5-(2,2-dimethylpropanoate)
|
| Molecular Formula |
C11H20O5
|
| Molecular Weight |
232.27
|
| Smiles |
COC1CC(O)C(COC(=O)C(C)(C)C)O1
|
COC1CC(O)C(COC(=O)C(C)(C)C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.