| Name |
2-[4-Benzyloxy-3-(1,3-dioxan-2-YL)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane
|
| Molecular Formula |
C22H27BO5
|
| Molecular Weight |
382.3
|
| Smiles |
CC1(C)COB(c2ccc(OCc3ccccc3)c(C3OCCCO3)c2)OC1
|
CC1(C)COB(c2ccc(OCc3ccccc3)c(C3OCCCO3)c2)OC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.