| Name | 1-chloro-4-(4-chloro-3-nitrophenyl)sulfonyl-2-nitrobenzene |
|---|---|
| Synonyms |
3,3'-dinitro-4,4'-dichlorodiphenyl sulfone
3,4'-dichlorodiphenyl sulfone 4.4'-Dichlor-3.3'-dinitro-diphenylsulfon bis(4-chloro-3-nitrophenyl)sulphone bis(4-chloro-3-nitrophenyl) sulfone Bis-(4-chlor-3-nitro-phenyl)-sulfon |
| Density | 1.673g/cm3 |
|---|---|
| Boiling Point | 561ºC at 760mmHg |
| Molecular Formula | C12H6Cl2N2O6S |
| Molecular Weight | 377.15700 |
| Flash Point | 293.1ºC |
| Exact Mass | 375.93200 |
| PSA | 134.16000 |
| LogP | 5.76980 |
| Vapour Pressure | 4.89E-12mmHg at 25°C |
| Index of Refraction | 1.647 |
| RIDADR | UN 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |