| Name |
3-(1,3-Benzodioxol-5-yl)-6-({[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)pyridazine
|
| Molecular Formula |
C20H13BrN4O3S
|
| Molecular Weight |
469.3
|
| Smiles |
Brc1cccc(-c2noc(CSc3ccc(-c4ccc5c(c4)OCO5)nn3)n2)c1
|
Brc1cccc(-c2noc(CSc3ccc(-c4ccc5c(c4)OCO5)nn3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.