| Name |
(E)-3-([2,2'-Bipyridin]-4-yl)acrylic acid
|
| Molecular Formula |
C13H10N2O2
|
| Molecular Weight |
226.23
|
| Smiles |
O=C(O)C=Cc1ccnc(-c2ccccn2)c1
|
O=C(O)C=Cc1ccnc(-c2ccccn2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.