| Name |
4'-Methoxy-3-methyl[1,1'-biphenyl]-4-methanol
|
| Molecular Formula |
C15H16O2
|
| Molecular Weight |
228.29
|
| Smiles |
COc1ccc(-c2ccc(CO)c(C)c2)cc1
|
COc1ccc(-c2ccc(CO)c(C)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.