| Name |
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[3-(propan-2-yl)-1H-1,2,4-triazol-5-yl]acetamide
|
| Molecular Formula |
C16H20N4O3
|
| Molecular Weight |
316.35
|
| Smiles |
CC(C)c1nc(NC(=O)Cc2ccc3c(c2)OCCCO3)n[nH]1
|
CC(C)c1nc(NC(=O)Cc2ccc3c(c2)OCCCO3)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.