| Name |
2-(6-cyclopentyl-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)acetamide
|
| Molecular Formula |
C16H21N6O3+
|
| Molecular Weight |
345.38
|
| Smiles |
Cc1c[n+]2c(n1C1CCCC1)N=C1C2C(=O)N(CC(N)=O)C(=O)N1C
|
Cc1c[n+]2c(n1C1CCCC1)N=C1C2C(=O)N(CC(N)=O)C(=O)N1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.