| Name |
4H-1,3,2-Benzodioxaphosphorin, 2-(4-propylphenoxy)-, 2-oxide
|
| Molecular Formula |
C16H17O4P
|
| Molecular Weight |
304.28
|
| Smiles |
CCCc1ccc(OP2(=O)OCc3ccccc3O2)cc1
|
CCCc1ccc(OP2(=O)OCc3ccccc3O2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.