| Name |
3-(Chloromethyl)-7-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
|
| Molecular Formula |
C12H9ClN4O
|
| Molecular Weight |
260.68
|
| Smiles |
O=c1c2nnc(CCl)n2ccn1-c1ccccc1
|
O=c1c2nnc(CCl)n2ccn1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.