| Name |
tert-Butyl (3aR)-tetrahydro-[1,2,3]oxathiazolo[3,4-a]pyrazine-5(3H)-carboxylate 1-oxide
|
| Molecular Formula |
C10H18N2O4S
|
| Molecular Weight |
262.33
|
| Smiles |
CC(C)(C)OC(=O)N1CCN2C(COS2=O)C1
|
CC(C)(C)OC(=O)N1CCN2C(COS2=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.