| Name |
(2Z)-8-(4-methoxyphenyl)-2-(2,4,5-trimethoxybenzylidene)-8,9-dihydro-7H-furo[2,3-f][1,3]benzoxazin-3(2H)-one
|
| Molecular Formula |
C27H25NO7
|
| Molecular Weight |
475.5
|
| Smiles |
COc1ccc(N2COc3ccc4c(c3C2)OC(=Cc2cc(OC)c(OC)cc2OC)C4=O)cc1
|
COc1ccc(N2COc3ccc4c(c3C2)OC(=Cc2cc(OC)c(OC)cc2OC)C4=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.