| Name |
3-(3,4-dimethoxyphenyl)-2-((2-methylbenzyl)thio)-6,7-dihydrothieno[3,2-d]pyrimidin-4(3H)-one
|
| Molecular Formula |
C22H22N2O3S2
|
| Molecular Weight |
426.6
|
| Smiles |
COc1ccc(-n2c(SCc3ccccc3C)nc3c(c2=O)SCC3)cc1OC
|
COc1ccc(-n2c(SCc3ccccc3C)nc3c(c2=O)SCC3)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.