| Name |
1-Pyrimidin-2-yl-1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate
|
| Molecular Formula |
C10H10F3N3O3S
|
| Molecular Weight |
309.27
|
| Smiles |
O=S(=O)(OC1=CCN(c2ncccn2)CC1)C(F)(F)F
|
O=S(=O)(OC1=CCN(c2ncccn2)CC1)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.