| Name |
3-(Tetrahydrofuran-3-yl oxy)-4-(thieno[3,2-d]pyrimidin-4-yl amino)-benzamide
|
| Molecular Formula |
C17H16N4O3S
|
| Molecular Weight |
356.4
|
| Smiles |
NC(=O)c1ccc(Nc2ncnc3ccsc23)c(OC2CCOC2)c1
|
NC(=O)c1ccc(Nc2ncnc3ccsc23)c(OC2CCOC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.