| Name |
6-(((4-methylpyrimidin-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 3,4,5-trimethoxybenzoate
|
| Molecular Formula |
C21H20N2O7S
|
| Molecular Weight |
444.5
|
| Smiles |
COc1cc(C(=O)Oc2coc(CSc3nccc(C)n3)cc2=O)cc(OC)c1OC
|
COc1cc(C(=O)Oc2coc(CSc3nccc(C)n3)cc2=O)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.