| Name |
3-[3,5-Bis(1,1-dimethylethyl)-1-methyl-4-oxo-2,5-cyclohexadien-1-yl]-2,4-pentanedione
|
| Molecular Formula |
C20H30O3
|
| Molecular Weight |
318.4
|
| Smiles |
CC(=O)C(C(C)=O)C1(C)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1
|
CC(=O)C(C(C)=O)C1(C)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.