| Name |
Octan-2-yl 2,3,5-triiodobenzoate
|
| Molecular Formula |
C15H19I3O2
|
| Molecular Weight |
612.02
|
| Smiles |
CCCCCCC(C)OC(=O)c1cc(I)cc(I)c1I
|
CCCCCCC(C)OC(=O)c1cc(I)cc(I)c1I
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.