| Name |
N'-{[3-(2,5-difluorobenzenesulfonyl)-1,3-oxazolidin-2-yl]methyl}-N-[2-(dimethylamino)ethyl]ethanediamide
|
| Molecular Formula |
C16H22F2N4O5S
|
| Molecular Weight |
420.4
|
| Smiles |
CN(C)CCNC(=O)C(=O)NCC1OCCN1S(=O)(=O)c1cc(F)ccc1F
|
CN(C)CCNC(=O)C(=O)NCC1OCCN1S(=O)(=O)c1cc(F)ccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.