| Name | amino-12-ethyl-9-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole | 
|---|---|
| Synonyms | amino-12-ethyl-9-pyrrolo[1',2':1,2]pyrazino[6,5-c]carbazole InChI=1/C19H16N4/c1-2-22-15-6-5-12(20)10-14(15)18-16(22)7-8-17-19(18)21-11-13-4-3-9-23(13)17/h3-11H,2,20H2,1H3 ARHLHTGQNJLJLO-UHFFFAOYSA | 
| Density | 1.37g/cm3 | 
|---|---|
| Boiling Point | 547.2ºC at 760 mmHg | 
| Molecular Formula | C19H16N4 | 
| Molecular Weight | 300.35700 | 
| Flash Point | 284.7ºC | 
| Exact Mass | 300.13700 | 
| PSA | 48.25000 | 
| LogP | 4.77870 | 
| Index of Refraction | 1.763 | 
| ~69%   82983-02-6 | 
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 | 
| Precursor 1 | |
|---|---|
| DownStream 0 | |