methanaminium, n,n,n-trimethyl-, salt with [[5-(2,2-dicyanoethenyl)-2h-pyran-3(6h)-ylidene]methyl]propanedinitrile (1:1) structure
|
Common Name | methanaminium, n,n,n-trimethyl-, salt with [[5-(2,2-dicyanoethenyl)-2h-pyran-3(6h)-ylidene]methyl]propanedinitrile (1:1) | ||
|---|---|---|---|---|
| CAS Number | 98826-83-6 | Molecular Weight | 309.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methanaminium, n,n,n-trimethyl-, salt with [[5-(2,2-dicyanoethenyl)-2h-pyran-3(6h)-ylidene]methyl]propanedinitrile (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19N5O |
|---|---|
| Molecular Weight | 309.36600 |
| Exact Mass | 309.15900 |
| PSA | 104.39000 |
| LogP | 1.78702 |
| InChIKey | LMWHJXMWIFZWPA-HAYVPLDLSA-N |
| SMILES | C[N+](C)(C)C.N#CC(=C=[N-])C=C1C=C(C=C(C#N)C#N)COC1 |
| propanedinitrile,[[5-(2,2-dicyanoethenyl)-2h-pyran-3(6h)-ylidene]methyl]-,ion(1-),n,n,n-trimethylmethanaminium |
| n,n,n-trimethylmethanaminium [[5-(2,2-dicyanoethenyl)-2h-pyran-3(6h)-ylidene]methyl]propanedinitrile |