bis(2,4,6-trimethylphenyl)iodanium,chloride
Modify Date: 2025-10-07 12:12:36
bis(2,4,6-trimethylphenyl)iodanium,chloride structure
|
Common Name | bis(2,4,6-trimethylphenyl)iodanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 98740-62-6 | Molecular Weight | 400.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22ClI | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,4,6-trimethylphenyl)iodanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22ClI |
|---|---|
| Molecular Weight | 400.72500 |
| Exact Mass | 400.04500 |
| InChIKey | WAKCRSHUCNABAR-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)c([I+]c2c(C)cc(C)cc2C)c(C)c1.[Cl-] |
|
~%
bis(2,4,6-trime... CAS#:98740-62-6 |
| Literature: Beringer et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 342,347 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:15433-03-1| Iodonium,bis(2,4,6-trimethylphenyl)-,chloride |
| Bis-<2.4.6-trimethyl-phenyl>-iodonium |
| dimesityl-iodonium,chloride |
| Dimesityl-jodonium,Chlorid |
| 2,2',4,4',6,6'-hexamethyl-diphenyliodonium chloride |