5-fluoro-1-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione structure
|
Common Name | 5-fluoro-1-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 98653-06-6 | Molecular Weight | 265.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8FN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-fluoro-1-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8FN3O4 |
|---|---|
| Molecular Weight | 265.19700 |
| Exact Mass | 265.05000 |
| PSA | 100.94000 |
| LogP | 1.56770 |
| InChIKey | LAENIKKHJFISTO-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2[N+](=O)[O-])cc1F |
|
~39%
5-fluoro-1-[(2-... CAS#:98653-06-6 |
| Literature: Lin, Tai-Shun; Wang, Lin; Antonini, Ippolito; Cosby, Lucille A.; Shiba, David A.; et al. Journal of Medicinal Chemistry, 1986 , vol. 29, # 1 p. 84 - 89 |
|
~23%
5-fluoro-1-[(2-... CAS#:98653-06-6 |
| Literature: Zhang, Zhouen; Hatta, Hiroshi; Ito, Takeo; Nishimoto, Sei-Ichi Organic and Biomolecular Chemistry, 2005 , vol. 3, # 4 p. 592 - 596 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(2'-nitrobenzyl)-5-fluorouracil |
| 2,4(1H,3H)-Pyrimidinedione,5-fluoro-1-[(2-nitrophenyl)methyl] |
| 1-(o-nitrobenzyl)-5-fluoroouracil |