2-(5,6-dihydroxy-1H-indol-2-yl)-1H-indole-5,6-diol structure
|
Common Name | 2-(5,6-dihydroxy-1H-indol-2-yl)-1H-indole-5,6-diol | ||
|---|---|---|---|---|
| CAS Number | 98192-27-9 | Molecular Weight | 296.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5,6-dihydroxy-1H-indol-2-yl)-1H-indole-5,6-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O4 |
|---|---|
| Molecular Weight | 296.27700 |
| Exact Mass | 296.08000 |
| PSA | 112.50000 |
| LogP | 3.13860 |
| InChIKey | JOKGEXDXSDUJIL-UHFFFAOYSA-N |
| SMILES | Oc1cc2cc(-c3cc4cc(O)c(O)cc4[nH]3)[nH]c2cc1O |
|
~%
2-(5,6-dihydrox... CAS#:98192-27-9 |
| Literature: Pezzella, Alessandro; Panzella, Lucia; Crescenzi, Orlando; Napolitano, Alessandra; Navaratman, Suppiah; Edge, Ruth; Land, Edward J.; Barone, Vincenzo; D'Ischia, Marco Journal of the American Chemical Society, 2006 , vol. 128, # 48 p. 15490 - 15498 |
|
~%
2-(5,6-dihydrox... CAS#:98192-27-9 |
| Literature: Napolitano, Alessandra; Corradini, Maria Grazia; Prota, Giuseppe Tetrahedron Letters, 1985 , vol. 26, # 23 p. 2805 - 2808 |
| 5,6,5',6'-tetrahydroxy-2,2'-biindolyl |
| 5,5',6,6'-tetrahydroxy-2,2'-biindolyl |
| [2,2'-Bi-1H-indole]-5,5',6,6'-tetrol |