2-cyano-3-(4-fluorophenyl)prop-2-enethioamide
Modify Date: 2024-02-16 19:14:41
2-cyano-3-(4-fluorophenyl)prop-2-enethioamide structure
|
Common Name | 2-cyano-3-(4-fluorophenyl)prop-2-enethioamide | ||
|---|---|---|---|---|
| CAS Number | 97579-25-4 | Molecular Weight | 206.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7FN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyano-3-(4-fluorophenyl)prop-2-enethioamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7FN2S |
|---|---|
| Molecular Weight | 206.23900 |
| Exact Mass | 206.03100 |
| PSA | 86.44000 |
| LogP | 2.73948 |
| InChIKey | TXTBVZMAVKCLRA-UHFFFAOYSA-N |
| SMILES | N#CC(=Cc1ccc(F)cc1)C(N)=S |
|
~%
2-cyano-3-(4-fl... CAS#:97579-25-4 |
| Literature: Brunskill,J.S.A. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 629 - 633 |
|
~%
2-cyano-3-(4-fl... CAS#:97579-25-4 |
| Literature: Brunskill, John S. A.; De, Asish; Ewing, David F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 4 - 7 |
| 4-fluorophenylmethylenecyanothioacetamide |
| p-fluorobenzylidenecyanothioacetamide |
| 2-cyano-3-(4-fluorophenyl)-2-propenethioamide |
| 2-Propenethioamide,2-cyano-3-(4-fluorophenyl) |
| 4-fluorobenzylidenecyanothioacetamide |