4-(4-methoxyphenyl)-5-pyridin-3-yl-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-methoxyphenyl)-5-pyridin-3-yl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 97422-28-1 | Molecular Weight | 283.34800 | |
| Density | 1.275g/cm3 | Boiling Point | 472ºC at 760mmHg | |
| Molecular Formula | C15H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | 4-(4-methoxyphenyl)-5-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760mmHg |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.34800 |
| Flash Point | 239.3ºC |
| Exact Mass | 283.07800 |
| PSA | 90.00000 |
| LogP | 3.39300 |
| InChIKey | NUYXENDTGLIWDX-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(N)sc2-c2cccnc2)cc1 |
|
~%
4-(4-methoxyphe... CAS#:97422-28-1 |
| Literature: Miwatashi, Seiji; Arikawa, Yasuyoshi; Naruo, Ken-Ichi; Igaki, Keiko; Watanabe, Yasumasa; Kimura, Hiroyuki; Kawamoto, Tomohiro; Ohkawa, Shigenori Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 410 - 418 |
|
~%
4-(4-methoxyphe... CAS#:97422-28-1 |
| Literature: Miwatashi, Seiji; Arikawa, Yasuyoshi; Naruo, Ken-Ichi; Igaki, Keiko; Watanabe, Yasumasa; Kimura, Hiroyuki; Kawamoto, Tomohiro; Ohkawa, Shigenori Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 410 - 418 |
|
~%
4-(4-methoxyphe... CAS#:97422-28-1 |
| Literature: Miwatashi, Seiji; Arikawa, Yasuyoshi; Naruo, Ken-Ichi; Igaki, Keiko; Watanabe, Yasumasa; Kimura, Hiroyuki; Kawamoto, Tomohiro; Ohkawa, Shigenori Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 410 - 418 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(4-Methoxyphenyl)-5-(3-pyridinyl)-2-thiazolamine |
| 2-Thiazolamine,4-(4-methoxyphenyl)-5-(3-pyridinyl) |
| [4-(4-methoxyphenyl)-5-(3-pyridyl)-1,3-thiazol-2-yl]amine |
| 2-Amino-4-(4-methoxyphenyl)-5-(3-pyridyl)-1,3-thiazole |
| 2-amino-4-(4-methoxyphenyl)-5-(pyridin-3-yl)-1,3-thiazole |
| [4-(4-Methoxyphenyl)-5-(pyridin-3-yl)-1,3-thiazol-2-yl]amine |