1,3-bis[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea structure
|
Common Name | 1,3-bis[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea | ||
|---|---|---|---|---|
| CAS Number | 97257-28-8 | Molecular Weight | 376.53400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|
| Molecular Formula | C25H32N2O |
|---|---|
| Molecular Weight | 376.53400 |
| Exact Mass | 376.25100 |
| PSA | 44.62000 |
| LogP | 6.81770 |
| InChIKey | CMDVXIWJXBSSND-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NC(C)(C)c2cccc(C(=C)C)c2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
1,3-bis[2-(3-pr... CAS#:97257-28-8 |
| Literature: Hoover,F.W.; Rothrock,H.S. Journal of Organic Chemistry, 1964 , vol. 29, p. 143 - 145 |
|
~%
1,3-bis[2-(3-pr... CAS#:97257-28-8 |
| Literature: Hoover,F.W.; Rothrock,H.S. Journal of Organic Chemistry, 1964 , vol. 29, p. 143 - 145 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |