4-amino-N-(2-ethyl-6-propan-2-ylphenyl)benzamide structure
|
Common Name | 4-amino-N-(2-ethyl-6-propan-2-ylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 97042-54-1 | Molecular Weight | 282.38000 | |
| Density | 1.114g/cm3 | Boiling Point | 378.6ºC at 760mmHg | |
| Molecular Formula | C18H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | 4-amino-N-(2-ethyl-6-propan-2-ylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760mmHg |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.38000 |
| Flash Point | 182.8ºC |
| Exact Mass | 282.17300 |
| PSA | 55.12000 |
| LogP | 4.86110 |
| Index of Refraction | 1.617 |
| InChIKey | FPAXDVIXYPASAK-UHFFFAOYSA-N |
| SMILES | CCc1cccc(C(C)C)c1NC(=O)c1ccc(N)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BENZANILIDE,4-AMINO-2'-ETHYL-6'-ISOPROPYL |
| 4-Amino-N-(2-ethyl-6-(1-methylethyl)phenyl)benzamide |
| 4-Amino-2'-ethyl-6'-isopropylbenzanilide |
| 4-AMINO-N-(2-ETHYL-6-PROPAN-2-YL-PHENYL)BENZAMIDE |
| Benzamide,4-amino-N-(2-ethyl-6-(1-methylethyl)phenyl) |