4-Methoxy-1-benzothiophene-2-sulfonyl chloride structure
|
Common Name | 4-Methoxy-1-benzothiophene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 96803-86-0 | Molecular Weight | 262.73300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Methoxy-1-benzothiophene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7ClO3S2 |
|---|---|
| Molecular Weight | 262.73300 |
| Exact Mass | 261.95300 |
| PSA | 79.99000 |
| LogP | 3.91820 |
| InChIKey | NWNPJGSCRUUWGS-UHFFFAOYSA-N |
| SMILES | COc1cccc2sc(S(=O)(=O)Cl)cc12 |
|
~%
4-Methoxy-1-ben... CAS#:96803-86-0 |
| Literature: Graham, Samuel L.; Shepard, Kenneth L.; Anderson, Paul S.; Baldwin, John J.; Best, Darryl B.; et al. Journal of Medicinal Chemistry, 1989 , vol. 32, # 12 p. 2548 - 2554 |
|
~%
4-Methoxy-1-ben... CAS#:96803-86-0 |
| Literature: Graham, Samuel L.; Shepard, Kenneth L.; Anderson, Paul S.; Baldwin, John J.; Best, Darryl B.; et al. Journal of Medicinal Chemistry, 1989 , vol. 32, # 12 p. 2548 - 2554 |
| 4-Methoxy-2-amino-benzaldehyd |
| 4-methoxy-2-aminobenzaldehyde |
| 4-methoxy-2-benzo[b]thiophenesulfonyl chloride |
| 2-aminoanisaldehyde |
| 2-formyl-5-methoxy-aniline |
| 2-AMINO-4-METHOXY-BENZALDEHYDE |
| Benzaldehyde,2-amino-4-methoxy |